C14H19ClN2O2S — CID 102666322
3-chloro-4-[[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methyl]benzenecarbothioamide (PubChem CID 102666322) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 3-chloro-4-[[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666322 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-chloro-4-[[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methyl]benzenecarbothioamide |
| SMILES | CC1COC(CO)CN1Cc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H19ClN2O2S/c1-9-8-19-12(7-18)6-17(9)5-11-3-2-10(14(16)20)4-13(11)15/h2-4,9,12,18H,5-8H2,1H3,(H2,16,20) |
| InChIKey | FPOWHLYFTQETLZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|