C13H17ClFNO2 — CID 86781915
[4-[(3-chloro-2-fluorophenyl)methyl]-5-methylmorpholin-2-yl]methanol (PubChem CID 86781915) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is [4-[(3-chloro-2-fluorophenyl)methyl]-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[(3-chloro-2-fluorophenyl)methyl]-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 86781915 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [4-[(3-chloro-2-fluorophenyl)methyl]-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H17ClFNO2/c1-9-8-18-11(7-17)6-16(9)5-10-3-2-4-12(14)13(10)15/h2-4,9,11,17H,5-8H2,1H3 |
| InChIKey | HYVJKROYQLQZRM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |