C18H22FN3O3S — CID 172882574
1-(6-fluoro-2-pyridinyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylpiperazine (PubChem CID 172882574) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(6-fluoro-2-pyridinyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylpiperazine.
| Compound Name | 1-(6-fluoro-2-pyridinyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 172882574 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(6-fluoro-2-pyridinyl)-4-(4-methoxy-3-methylphenyl)sulfonyl-2-methylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cccc(F)n3)C(C)C2)cc1C |
| InChI | InChI=1S/C18H22FN3O3S/c1-13-11-15(7-8-16(13)25-3)26(23,24)21-9-10-22(14(2)12-21)18-6-4-5-17(19)20-18/h4-8,11,14H,9-10,12H2,1-3H3 |
| InChIKey | RJAYLNVQQJAVMZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|