C18H18N2O5S — CID 129339619
6-[(3S)-3-[(6-methyl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonyl-3H-2-benzofuran-1-one (PubChem CID 129339619) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 6-[(3S)-3-[(6-methyl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonyl-3H-2-benzofuran-1-one.
| Compound Name | 6-[(3S)-3-[(6-methyl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 129339619 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-[(3S)-3-[(6-methyl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonyl-3H-2-benzofuran-1-one |
| SMILES | Cc1ccc(O[C@H]2CCN(S(=O)(=O)c3ccc4c(c3)C(=O)OC4)C2)cn1 |
| InChI | InChI=1S/C18H18N2O5S/c1-12-2-4-14(9-19-12)25-15-6-7-20(10-15)26(22,23)16-5-3-13-11-24-18(21)17(13)8-16/h2-5,8-9,15H,6-7,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | WEBSRUFKXWWPPY-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |