C21H20F3N3O6S — CID 37159497
(6-nitro-2,3-dihydroindol-1-yl)-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]methanone (PubChem CID 37159497) has the molecular formula C21H20F3N3O6S and a molecular weight of 499.47 g/mol. Its IUPAC name is (6-nitro-2,3-dihydroindol-1-yl)-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]methanone.
| Compound Name | (6-nitro-2,3-dihydroindol-1-yl)-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 37159497 |
| Molecular Formula | C21H20F3N3O6S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (6-nitro-2,3-dihydroindol-1-yl)-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H20F3N3O6S/c22-21(23,24)33-17-2-1-3-18(13-17)34(31,32)25-9-6-15(7-10-25)20(28)26-11-8-14-4-5-16(27(29)30)12-19(14)26/h1-5,12-13,15H,6-11H2 |
| InChIKey | WIRKHLZXIOHJEY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|