C21H24N4O2S — CID 20914787
1-(2,5-dimethylphenyl)-4-(4-pyrazol-1-ylphenyl)sulfonylpiperazine (PubChem CID 20914787) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-(4-pyrazol-1-ylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,5-dimethylphenyl)-4-(4-pyrazol-1-ylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 20914787 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-(4-pyrazol-1-ylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(C)c(N2CCN(S(=O)(=O)c3ccc(-n4cccn4)cc3)CC2)c1 |
| InChI | InChI=1S/C21H24N4O2S/c1-17-4-5-18(2)21(16-17)23-12-14-24(15-13-23)28(26,27)20-8-6-19(7-9-20)25-11-3-10-22-25/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | NJHHTOSABSJODK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |