C20H24N2O4S — CID 45314761
4-methyl-3-[4-(2-phenylethyl)piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 45314761) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-methyl-3-[4-(2-phenylethyl)piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-methyl-3-[4-(2-phenylethyl)piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 45314761 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-methyl-3-[4-(2-phenylethyl)piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O4S/c1-16-7-8-18(20(23)24)15-19(16)27(25,26)22-13-11-21(12-14-22)10-9-17-5-3-2-4-6-17/h2-8,15H,9-14H2,1H3,(H,23,24) |
| InChIKey | QDWKOUGRTHDAAB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |