C18H27ClFN3O3S — CID 131931460
2-[4-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 131931460) has the molecular formula C18H27ClFN3O3S and a molecular weight of 419.95 g/mol. Its IUPAC name is 2-[4-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 131931460 |
| Molecular Formula | C18H27ClFN3O3S |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[4-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(N3CCN(CCO)CC3)CC2)c(Cl)cc1F |
| InChI | InChI=1S/C18H27ClFN3O3S/c1-14-12-18(16(19)13-17(14)20)27(25,26)23-4-2-15(3-5-23)22-8-6-21(7-9-22)10-11-24/h12-13,15,24H,2-11H2,1H3 |
| InChIKey | ZMIHBLLDFGGURR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |