C15H18ClFN2O6S — CID 3741176
2-chloro-5-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]sulfonyl-4-fluorobenzoic acid (PubChem CID 3741176) has the molecular formula C15H18ClFN2O6S and a molecular weight of 408.84 g/mol. Its IUPAC name is 2-chloro-5-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]sulfonyl-4-fluorobenzoic acid.
| Compound Name | 2-chloro-5-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]sulfonyl-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 3741176 |
| Molecular Formula | C15H18ClFN2O6S |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-chloro-5-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]sulfonyl-4-fluorobenzoic acid |
| SMILES | CCOC(=O)CN1CCN(S(=O)(=O)c2cc(C(=O)O)c(Cl)cc2F)CC1 |
| InChI | InChI=1S/C15H18ClFN2O6S/c1-2-25-14(20)9-18-3-5-19(6-4-18)26(23,24)13-7-10(15(21)22)11(16)8-12(13)17/h7-8H,2-6,9H2,1H3,(H,21,22) |
| InChIKey | MZILNDPGWIRRKJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |