C10H15FN2O2S — CID 165485847
N-[4-(aminomethyl)-2-fluorophenyl]-N-methylethanesulfonamide (PubChem CID 165485847) has the molecular formula C10H15FN2O2S and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[4-(aminomethyl)-2-fluorophenyl]-N-methylethanesulfonamide.
| Compound Name | N-[4-(aminomethyl)-2-fluorophenyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 165485847 |
| Molecular Formula | C10H15FN2O2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[4-(aminomethyl)-2-fluorophenyl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)c1ccc(CN)cc1F |
| InChI | InChI=1S/C10H15FN2O2S/c1-3-16(14,15)13(2)10-5-4-8(7-12)6-9(10)11/h4-6H,3,7,12H2,1-2H3 |
| InChIKey | RTSJLCPZWOWEST-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |