C10H15N3O4S2 — CID 114614213
5-[bis(2-hydroxyethyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614213) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-[bis(2-hydroxyethyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[bis(2-hydroxyethyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614213 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-[bis(2-hydroxyethyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N(CCO)CCO)cn1 |
| InChI | InChI=1S/C10H15N3O4S2/c11-10(18)9-2-1-8(7-12-9)19(16,17)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6H2,(H2,11,18) |
| InChIKey | IVAGEHIHRCVPSO-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|