C17H29N3 — CID 79313102
N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-phenylpropane-1,3-diamine (PubChem CID 79313102) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-phenylpropane-1,3-diamine.
| Compound Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79313102 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-phenylpropane-1,3-diamine |
| SMILES | CCN1CCCC1CN(C)CCCNc1ccccc1 |
| InChI | InChI=1S/C17H29N3/c1-3-20-14-7-11-17(20)15-19(2)13-8-12-18-16-9-5-4-6-10-16/h4-6,9-10,17-18H,3,7-8,11-15H2,1-2H3 |
| InChIKey | HJORPOUZNIXDRS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|