C17H37N3 — CID 79313161
N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-propylhexane-1,6-diamine (PubChem CID 79313161) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-propylhexane-1,6-diamine.
| Compound Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 79313161 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-propylhexane-1,6-diamine |
| SMILES | CCCNCCCCCCN(C)CC1CCCN1CC |
| InChI | InChI=1S/C17H37N3/c1-4-12-18-13-8-6-7-9-14-19(3)16-17-11-10-15-20(17)5-2/h17-18H,4-16H2,1-3H3 |
| InChIKey | IRISJDQQMHHCAI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|