C16H29N3S — CID 79312516
N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 79312516) has the molecular formula C16H29N3S and a molecular weight of 295.50 g/mol. Its IUPAC name is N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 79312516 |
| Molecular Formula | C16H29N3S |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N'-[(1-ethylpyrrolidin-2-yl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCN1CCCC1CN(C)CCNCCc1cccs1 |
| InChI | InChI=1S/C16H29N3S/c1-3-19-11-4-6-15(19)14-18(2)12-10-17-9-8-16-7-5-13-20-16/h5,7,13,15,17H,3-4,6,8-12,14H2,1-2H3 |
| InChIKey | YWTJGSDRPJGLLQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|