C19H34IN5OS — CID 110038754
2-[[[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110038754) has the molecular formula C19H34IN5OS and a molecular weight of 507.49 g/mol. Its IUPAC name is 2-[[[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110038754 |
| Molecular Formula | C19H34IN5OS |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 2-[[[(1-ethylpyrrolidin-2-yl)methyl-methylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN1CCCC1CN(C)/C(=N/CC(=O)N(C)C)NCCc1cccs1.I |
| InChI | InChI=1S/C19H33N5OS.HI/c1-5-24-12-6-8-16(24)15-23(4)19(21-14-18(25)22(2)3)20-11-10-17-9-7-13-26-17;/h7,9,13,16H,5-6,8,10-12,14-15H2,1-4H3,(H,20,21);1H |
| InChIKey | UVKITVZWJXCFHX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|