C16H28N2 — CID 65266664
1-N-benzyl-1-N-ethyl-2,2,3-trimethylbutane-1,3-diamine (PubChem CID 65266664) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-N-benzyl-1-N-ethyl-2,2,3-trimethylbutane-1,3-diamine.
| Compound Name | 1-N-benzyl-1-N-ethyl-2,2,3-trimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 65266664 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-N-benzyl-1-N-ethyl-2,2,3-trimethylbutane-1,3-diamine |
| SMILES | CCN(Cc1ccccc1)CC(C)(C)C(C)(C)N |
| InChI | InChI=1S/C16H28N2/c1-6-18(12-14-10-8-7-9-11-14)13-15(2,3)16(4,5)17/h7-11H,6,12-13,17H2,1-5H3 |
| InChIKey | FZBMIKZUSCFEST-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |