C20H29Cl2N3O — CID 119522718
N-(1-amino-2-methylpropan-2-yl)-2-(dibenzylamino)acetamide;dihydrochloride (PubChem CID 119522718) has the molecular formula C20H29Cl2N3O and a molecular weight of 398.38 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-(dibenzylamino)acetamide;dihydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-(dibenzylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119522718 |
| Molecular Formula | C20H29Cl2N3O |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-(dibenzylamino)acetamide;dihydrochloride |
| SMILES | CC(C)(CN)NC(=O)CN(Cc1ccccc1)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H27N3O.2ClH/c1-20(2,16-21)22-19(24)15-23(13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18;;/h3-12H,13-16,21H2,1-2H3,(H,22,24);2*1H |
| InChIKey | CXLGCGDJUFWYSB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |