C27H31N3OS — CID 101153293
2-(dibenzylamino)-N-[2-methyl-1-(N-methylanilino)-1-sulfanylidenepropan-2-yl]acetamide (PubChem CID 101153293) has the molecular formula C27H31N3OS and a molecular weight of 445.63 g/mol. Its IUPAC name is 2-(dibenzylamino)-N-[2-methyl-1-(N-methylanilino)-1-sulfanylidenepropan-2-yl]acetamide.
| Compound Name | 2-(dibenzylamino)-N-[2-methyl-1-(N-methylanilino)-1-sulfanylidenepropan-2-yl]acetamide |
|---|---|
| PubChem CID | 101153293 |
| Molecular Formula | C27H31N3OS |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-(dibenzylamino)-N-[2-methyl-1-(N-methylanilino)-1-sulfanylidenepropan-2-yl]acetamide |
| SMILES | CN(C(=S)C(C)(C)NC(=O)CN(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N3OS/c1-27(2,26(32)29(3)24-17-11-6-12-18-24)28-25(31)21-30(19-22-13-7-4-8-14-22)20-23-15-9-5-10-16-23/h4-18H,19-21H2,1-3H3,(H,28,31) |
| InChIKey | MAKJGFWARUZEQZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|