About 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide
5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide (PubChem CID 102177116) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide.
Molecular Properties
| Compound Name | 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide |
| PubChem CID | 102177116 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide |
| SMILES | CN(C(=O)C(C)(C)NC(=O)CC(C)(C)CCO)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O3/c1-17(2,11-12-21)13-15(22)19-18(3,4)16(23)20(5)14-9-7-6-8-10-14/h6-10,21H,11-13H2,1-5H3,(H,19,22) |
| InChIKey | SZQMBMZHTMBJQV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide?
The IUPAC name of 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide (CID 102177116) is 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide.
What is the SMILES notation for 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide?
The canonical SMILES for 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide is CN(C(=O)C(C)(C)NC(=O)CC(C)(C)CCO)c1ccccc1.
What is the InChIKey of 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide?
The InChIKey is SZQMBMZHTMBJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O3/c1-17(2,11-12-21)13-15(22)19-18(3,4)16(23)20(5)14-9-7-6-8-10-14/h6-10,21H,11-13H2,1-5H3,(H,19,22).
What are the key properties of 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide?
5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide has a molecular weight of 320.43 g/mol, XLogP of 2.34, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,3-dimethyl-N-[2-methyl-1-(N-methylanilino)-1-oxopropan-2-yl]pentanamide is sourced from PubChem (CID 102177116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).