C19H16O7 — CID 174566620
1-[4-benzoyl-3,5-bis(2-hydroxyacetyl)phenyl]-2-hydroxyethanone (PubChem CID 174566620) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-[4-benzoyl-3,5-bis(2-hydroxyacetyl)phenyl]-2-hydroxyethanone.
| Compound Name | 1-[4-benzoyl-3,5-bis(2-hydroxyacetyl)phenyl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 174566620 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-[4-benzoyl-3,5-bis(2-hydroxyacetyl)phenyl]-2-hydroxyethanone |
| SMILES | O=C(CO)c1cc(C(=O)CO)c(C(=O)c2ccccc2)c(C(=O)CO)c1 |
| InChI | InChI=1S/C19H16O7/c20-8-15(23)12-6-13(16(24)9-21)18(14(7-12)17(25)10-22)19(26)11-4-2-1-3-5-11/h1-7,20-22H,8-10H2 |
| InChIKey | YDZOBOJTSCDCOM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |