C14H12Br2O2 — CID 134893575
2,3-dibromo-3-(6-methylnaphthalen-2-yl)propanoic acid (PubChem CID 134893575) has the molecular formula C14H12Br2O2 and a molecular weight of 372.06 g/mol. Its IUPAC name is 2,3-dibromo-3-(6-methylnaphthalen-2-yl)propanoic acid.
| Compound Name | 2,3-dibromo-3-(6-methylnaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 134893575 |
| Molecular Formula | C14H12Br2O2 |
| Molecular Weight | 372.06 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 2,3-dibromo-3-(6-methylnaphthalen-2-yl)propanoic acid |
| SMILES | Cc1ccc2cc(C(Br)C(Br)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C14H12Br2O2/c1-8-2-3-10-7-11(5-4-9(10)6-8)12(15)13(16)14(17)18/h2-7,12-13H,1H3,(H,17,18) |
| InChIKey | FTMFMTNTJJQTNL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|