C16H19NO2 — CID 116937993
3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid (PubChem CID 116937993) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid.
| Compound Name | 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 116937993 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid |
| SMILES | Cc1ccc2cc(C(N)C(C)(C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C16H19NO2/c1-10-4-5-12-9-13(7-6-11(12)8-10)14(17)16(2,3)15(18)19/h4-9,14H,17H2,1-3H3,(H,18,19) |
| InChIKey | WOYNKZXIKSVKQJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |