3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid

C16H19NO2 — CID 116937993

IUPAC3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid
SMILESCc1ccc2cc(C(N)C(C)(C)C(=O)O)ccc2c1
InChIInChI=1S/C16H19NO2/c1-10-4-5-12-9-13(7-6-11(12)8-10)14(17)16(2,3)15(18)19/h4-9,14H,17H2,1-3H3,(H,18,19)
InChIKeyWOYNKZXIKSVKQJ-UHFFFAOYSA-N
MW257.33 g/mol
LogP3.26
Rot. Bonds3

About 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid

3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid (PubChem CID 116937993) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid
PubChem CID116937993
Molecular FormulaC16H19NO2
Molecular Weight257.33 g/mol
Exact Mass257.14
IUPAC Name3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid
SMILESCc1ccc2cc(C(N)C(C)(C)C(=O)O)ccc2c1
InChIInChI=1S/C16H19NO2/c1-10-4-5-12-9-13(7-6-11(12)8-10)14(17)16(2,3)15(18)19/h4-9,14H,17H2,1-3H3,(H,18,19)
InChIKeyWOYNKZXIKSVKQJ-UHFFFAOYSA-N
XLogP3.26
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 53.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid?
The IUPAC name of 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid (CID 116937993) is 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid.
What is the SMILES notation for 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid?
The canonical SMILES for 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid is Cc1ccc2cc(C(N)C(C)(C)C(=O)O)ccc2c1.
What is the InChIKey of 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid?
The InChIKey is WOYNKZXIKSVKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-10-4-5-12-9-13(7-6-11(12)8-10)14(17)16(2,3)15(18)19/h4-9,14H,17H2,1-3H3,(H,18,19).
What are the key properties of 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid?
3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid has a molecular weight of 257.33 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-dimethyl-3-(6-methylnaphthalen-2-yl)propanoic acid is sourced from PubChem (CID 116937993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).