C13H17Br2NO2 — CID 131861259
2,3-dibromo-3-[4-(diethylamino)phenyl]propanoic acid (PubChem CID 131861259) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is 2,3-dibromo-3-[4-(diethylamino)phenyl]propanoic acid.
| Compound Name | 2,3-dibromo-3-[4-(diethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 131861259 |
| Molecular Formula | C13H17Br2NO2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 2,3-dibromo-3-[4-(diethylamino)phenyl]propanoic acid |
| SMILES | CCN(CC)c1ccc(C(Br)C(Br)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17Br2NO2/c1-3-16(4-2)10-7-5-9(6-8-10)11(14)12(15)13(17)18/h5-8,11-12H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | XEYPZENCSUHXOQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|