C14H20O6 — CID 102305426
(2R,3R,4R,5R)-1-(4-ethenylphenyl)hexane-1,2,3,4,5,6-hexol (PubChem CID 102305426) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-(4-ethenylphenyl)hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4R,5R)-1-(4-ethenylphenyl)hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 102305426 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2R,3R,4R,5R)-1-(4-ethenylphenyl)hexane-1,2,3,4,5,6-hexol |
| SMILES | C=Cc1ccc(C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C14H20O6/c1-2-8-3-5-9(6-4-8)11(17)13(19)14(20)12(18)10(16)7-15/h2-6,10-20H,1,7H2/t10-,11?,12-,13-,14+/m1/s1 |
| InChIKey | RSBYBDLFAIIAMF-RFLLOBDJSA-N |
| XLogP | -1.20 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |