C12H16O6 — CID 11043342
(3S,4R,5R,6S)-1,3,4,5,6-pentahydroxy-6-phenylhexan-2-one (PubChem CID 11043342) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is (3S,4R,5R,6S)-1,3,4,5,6-pentahydroxy-6-phenylhexan-2-one.
| Compound Name | (3S,4R,5R,6S)-1,3,4,5,6-pentahydroxy-6-phenylhexan-2-one |
|---|---|
| PubChem CID | 11043342 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3S,4R,5R,6S)-1,3,4,5,6-pentahydroxy-6-phenylhexan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H16O6/c13-6-8(14)10(16)12(18)11(17)9(15)7-4-2-1-3-5-7/h1-5,9-13,15-18H,6H2/t9-,10+,11+,12-/m0/s1 |
| InChIKey | HOVUZRROWXFAHI-QCNOEVLYSA-N |
| XLogP | -1.64 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |