C10H11NO5S — CID 43384942
2-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]ethanol (PubChem CID 43384942) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]ethanol.
| Compound Name | 2-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]ethanol |
|---|---|
| PubChem CID | 43384942 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]ethanol |
| SMILES | O=[N+]([O-])c1cc2c(cc1SCCO)OCCO2 |
| InChI | InChI=1S/C10H11NO5S/c12-1-4-17-10-6-9-8(15-2-3-16-9)5-7(10)11(13)14/h5-6,12H,1-4H2 |
| InChIKey | PQEXDJYUAGRKGL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|