C12H13NO6S — CID 66114584
3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]butanoic acid (PubChem CID 66114584) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]butanoic acid.
| Compound Name | 3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 66114584 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[(7-nitro-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)Sc1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C12H13NO6S/c1-7(4-12(14)15)20-11-6-10-9(18-2-3-19-10)5-8(11)13(16)17/h5-7H,2-4H2,1H3,(H,14,15) |
| InChIKey | LTGDFNKJCHYFGQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|