About (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal
(2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal (PubChem CID 173315018) has the molecular formula C17H18N2O7
and a molecular weight of 362.34 g/mol. Its IUPAC name is (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal.
Molecular Properties
| Compound Name | (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal |
| PubChem CID | 173315018 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal |
| SMILES | O=CCCOCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1CO |
| InChI | InChI=1S/C10H11NO4.C7H7NO3/c12-6-3-7-15-8-9-4-1-2-5-10(9)11(13)14;9-5-6-3-1-2-4-7(6)8(10)11/h1-2,4-6H,3,7-8H2;1-4,9H,5H2 |
| InChIKey | WBQJYEQPEQTRIG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal?
The IUPAC name of (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal (CID 173315018) is (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal.
What is the SMILES notation for (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal?
The canonical SMILES for (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal is O=CCCOCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1CO.
What is the InChIKey of (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal?
The InChIKey is WBQJYEQPEQTRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4.C7H7NO3/c12-6-3-7-15-8-9-4-1-2-5-10(9)11(13)14;9-5-6-3-1-2-4-7(6)8(10)11/h1-2,4-6H,3,7-8H2;1-4,9H,5H2.
What are the key properties of (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal?
(2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal has a molecular weight of 362.34 g/mol, XLogP of 2.79, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methanol;3-[(2-nitrophenyl)methoxy]propanal is sourced from PubChem (CID 173315018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).