About (2-nitrophenyl)selanyl cyanate
(2-nitrophenyl)selanyl cyanate (PubChem CID 11379526) has the molecular formula C7H4N2O3Se
and a molecular weight of 243.08 g/mol. Its IUPAC name is (2-nitrophenyl)selanyl cyanate.
Molecular Properties
| Compound Name | (2-nitrophenyl)selanyl cyanate |
| PubChem CID | 11379526 |
| Molecular Formula | C7H4N2O3Se |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | (2-nitrophenyl)selanyl cyanate |
| SMILES | N#CO[Se]c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4N2O3Se/c8-5-12-13-7-4-2-1-3-6(7)9(10)11/h1-4H |
| InChIKey | QDRXRBUXLFRISD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)selanyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)selanyl cyanate?
The IUPAC name of (2-nitrophenyl)selanyl cyanate (CID 11379526) is (2-nitrophenyl)selanyl cyanate.
What is the SMILES notation for (2-nitrophenyl)selanyl cyanate?
The canonical SMILES for (2-nitrophenyl)selanyl cyanate is N#CO[Se]c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)selanyl cyanate?
The InChIKey is QDRXRBUXLFRISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3Se/c8-5-12-13-7-4-2-1-3-6(7)9(10)11/h1-4H.
What are the key properties of (2-nitrophenyl)selanyl cyanate?
(2-nitrophenyl)selanyl cyanate has a molecular weight of 243.08 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)selanyl cyanate is sourced from PubChem (CID 11379526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).