About cyano 2-nitrobenzoate
cyano 2-nitrobenzoate (PubChem CID 154624336) has the molecular formula C8H4N2O4
and a molecular weight of 192.13 g/mol. Its IUPAC name is cyano 2-nitrobenzoate.
Molecular Properties
| Compound Name | cyano 2-nitrobenzoate |
| PubChem CID | 154624336 |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | cyano 2-nitrobenzoate |
| SMILES | N#COC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4N2O4/c9-5-14-8(11)6-3-1-2-4-7(6)10(12)13/h1-4H |
| InChIKey | RUAILHBQWCAVDO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyano 2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano 2-nitrobenzoate?
The IUPAC name of cyano 2-nitrobenzoate (CID 154624336) is cyano 2-nitrobenzoate.
What is the SMILES notation for cyano 2-nitrobenzoate?
The canonical SMILES for cyano 2-nitrobenzoate is N#COC(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of cyano 2-nitrobenzoate?
The InChIKey is RUAILHBQWCAVDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O4/c9-5-14-8(11)6-3-1-2-4-7(6)10(12)13/h1-4H.
What are the key properties of cyano 2-nitrobenzoate?
cyano 2-nitrobenzoate has a molecular weight of 192.13 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyano 2-nitrobenzoate is sourced from PubChem (CID 154624336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).