About (2-nitrobenzoyl) 2-(hydroxyamino)benzoate
(2-nitrobenzoyl) 2-(hydroxyamino)benzoate (PubChem CID 175536573) has the molecular formula C14H10N2O6
and a molecular weight of 302.24 g/mol. Its IUPAC name is (2-nitrobenzoyl) 2-(hydroxyamino)benzoate.
Molecular Properties
| Compound Name | (2-nitrobenzoyl) 2-(hydroxyamino)benzoate |
| PubChem CID | 175536573 |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2-nitrobenzoyl) 2-(hydroxyamino)benzoate |
| SMILES | O=C(OC(=O)c1ccccc1[N+](=O)[O-])c1ccccc1NO |
| InChI | InChI=1S/C14H10N2O6/c17-13(9-5-1-3-7-11(9)15-19)22-14(18)10-6-2-4-8-12(10)16(20)21/h1-8,15,19H |
| InChIKey | KTYRBSMYLIEIHU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrobenzoyl) 2-(hydroxyamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrobenzoyl) 2-(hydroxyamino)benzoate?
The IUPAC name of (2-nitrobenzoyl) 2-(hydroxyamino)benzoate (CID 175536573) is (2-nitrobenzoyl) 2-(hydroxyamino)benzoate.
What is the SMILES notation for (2-nitrobenzoyl) 2-(hydroxyamino)benzoate?
The canonical SMILES for (2-nitrobenzoyl) 2-(hydroxyamino)benzoate is O=C(OC(=O)c1ccccc1[N+](=O)[O-])c1ccccc1NO.
What is the InChIKey of (2-nitrobenzoyl) 2-(hydroxyamino)benzoate?
The InChIKey is KTYRBSMYLIEIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O6/c17-13(9-5-1-3-7-11(9)15-19)22-14(18)10-6-2-4-8-12(10)16(20)21/h1-8,15,19H.
What are the key properties of (2-nitrobenzoyl) 2-(hydroxyamino)benzoate?
(2-nitrobenzoyl) 2-(hydroxyamino)benzoate has a molecular weight of 302.24 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrobenzoyl) 2-(hydroxyamino)benzoate is sourced from PubChem (CID 175536573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).