About [amino-(2-nitrobenzoyl)amino] cyanoformate
[amino-(2-nitrobenzoyl)amino] cyanoformate (PubChem CID 91114229) has the molecular formula C9H6N4O5
and a molecular weight of 250.17 g/mol. Its IUPAC name is [amino-(2-nitrobenzoyl)amino] cyanoformate.
Molecular Properties
| Compound Name | [amino-(2-nitrobenzoyl)amino] cyanoformate |
| PubChem CID | 91114229 |
| Molecular Formula | C9H6N4O5 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | [amino-(2-nitrobenzoyl)amino] cyanoformate |
| SMILES | N#CC(=O)ON(N)C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6N4O5/c10-5-8(14)18-12(11)9(15)6-3-1-2-4-7(6)13(16)17/h1-4H,11H2 |
| InChIKey | OUEYCRGGOINJLJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [amino-(2-nitrobenzoyl)amino] cyanoformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-(2-nitrobenzoyl)amino] cyanoformate?
The IUPAC name of [amino-(2-nitrobenzoyl)amino] cyanoformate (CID 91114229) is [amino-(2-nitrobenzoyl)amino] cyanoformate.
What is the SMILES notation for [amino-(2-nitrobenzoyl)amino] cyanoformate?
The canonical SMILES for [amino-(2-nitrobenzoyl)amino] cyanoformate is N#CC(=O)ON(N)C(=O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of [amino-(2-nitrobenzoyl)amino] cyanoformate?
The InChIKey is OUEYCRGGOINJLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O5/c10-5-8(14)18-12(11)9(15)6-3-1-2-4-7(6)13(16)17/h1-4H,11H2.
What are the key properties of [amino-(2-nitrobenzoyl)amino] cyanoformate?
[amino-(2-nitrobenzoyl)amino] cyanoformate has a molecular weight of 250.17 g/mol, XLogP of -0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-(2-nitrobenzoyl)amino] cyanoformate is sourced from PubChem (CID 91114229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).