C12H11N3O4 — CID 54716787
(Z)-2-cyano-3-hydroxy-N,N-dimethyl-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 54716787) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is (Z)-2-cyano-3-hydroxy-N,N-dimethyl-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-hydroxy-N,N-dimethyl-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54716787 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (Z)-2-cyano-3-hydroxy-N,N-dimethyl-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C(\O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O4/c1-14(2)12(17)9(7-13)11(16)8-5-3-4-6-10(8)15(18)19/h3-6,16H,1-2H3/b11-9- |
| InChIKey | DNUZOVQBEHSIBR-LUAWRHEFSA-N |
| XLogP | 1.48 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|