C10H9N3O5 — CID 67899733
2-cyano-3-hydroxy-N,N-dimethyl-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 67899733) has the molecular formula C10H9N3O5 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-cyano-3-hydroxy-N,N-dimethyl-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-hydroxy-N,N-dimethyl-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67899733 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-cyano-3-hydroxy-N,N-dimethyl-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | CN(C)C(=O)C(C#N)=C(O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C10H9N3O5/c1-12(2)10(15)6(5-11)9(14)7-3-4-8(18-7)13(16)17/h3-4,14H,1-2H3 |
| InChIKey | HROHZHFHGFOVKN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|