About 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol
1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol (PubChem CID 159929831) has the molecular formula C13H10Br2N2O6
and a molecular weight of 450.04 g/mol. Its IUPAC name is 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol.
Molecular Properties
| Compound Name | 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol |
| PubChem CID | 159929831 |
| Molecular Formula | C13H10Br2N2O6 |
| Molecular Weight | 450.04 g/mol |
| Exact Mass | 447.89 |
| IUPAC Name | 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol |
| SMILES | COc1c(Br)cccc1[N+](=O)[O-].O=[N+]([O-])c1cccc(Br)c1O |
| InChI | InChI=1S/C7H6BrNO3.C6H4BrNO3/c1-12-7-5(8)3-2-4-6(7)9(10)11;7-4-2-1-3-5(6(4)9)8(10)11/h2-4H,1H3;1-3,9H |
| InChIKey | NZMNFGCTKPYFEJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol?
The IUPAC name of 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol (CID 159929831) is 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol.
What is the SMILES notation for 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol?
The canonical SMILES for 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol is COc1c(Br)cccc1[N+](=O)[O-].O=[N+]([O-])c1cccc(Br)c1O.
What is the InChIKey of 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol?
The InChIKey is NZMNFGCTKPYFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO3.C6H4BrNO3/c1-12-7-5(8)3-2-4-6(7)9(10)11;7-4-2-1-3-5(6(4)9)8(10)11/h2-4H,1H3;1-3,9H.
What are the key properties of 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol?
1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol has a molecular weight of 450.04 g/mol, XLogP of 4.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methoxy-3-nitrobenzene;2-bromo-6-nitrophenol is sourced from PubChem (CID 159929831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).