About 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol
10-methoxy-3,8-dinitrophenazin-10-ium-2-ol (PubChem CID 163378644) has the molecular formula C13H9N4O6+
and a molecular weight of 317.24 g/mol. Its IUPAC name is 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol.
Molecular Properties
| Compound Name | 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol |
| PubChem CID | 163378644 |
| Molecular Formula | C13H9N4O6+ |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol |
| SMILES | CO[n+]1c2cc([N+](=O)[O-])ccc2nc2cc([N+](=O)[O-])c(O)cc21 |
| InChI | InChI=1S/C13H8N4O6/c1-23-15-10-4-7(16(19)20)2-3-8(10)14-9-5-12(17(21)22)13(18)6-11(9)15/h2-6H,1H3/p+1 |
| InChIKey | FFBGMWSPIZOZDU-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol?
The IUPAC name of 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol (CID 163378644) is 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol.
What is the SMILES notation for 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol?
The canonical SMILES for 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol is CO[n+]1c2cc([N+](=O)[O-])ccc2nc2cc([N+](=O)[O-])c(O)cc21.
What is the InChIKey of 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol?
The InChIKey is FFBGMWSPIZOZDU-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H8N4O6/c1-23-15-10-4-7(16(19)20)2-3-8(10)14-9-5-12(17(21)22)13(18)6-11(9)15/h2-6H,1H3/p+1.
What are the key properties of 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol?
10-methoxy-3,8-dinitrophenazin-10-ium-2-ol has a molecular weight of 317.24 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-3,8-dinitrophenazin-10-ium-2-ol is sourced from PubChem (CID 163378644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).