About 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol
3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol (PubChem CID 163378657) has the molecular formula C12H6N4O7
and a molecular weight of 318.20 g/mol. Its IUPAC name is 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol.
Molecular Properties
| Compound Name | 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol |
| PubChem CID | 163378657 |
| Molecular Formula | C12H6N4O7 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[n+]([O-])c1cc(O)c([N+](=O)[O-])cc1[n+]2[O-] |
| InChI | InChI=1S/C12H6N4O7/c17-12-5-10-9(4-11(12)16(22)23)13(18)7-2-1-6(15(20)21)3-8(7)14(10)19/h1-5,17H |
| InChIKey | ZRKBZGXXYPYXGF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol?
The IUPAC name of 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol (CID 163378657) is 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol.
What is the SMILES notation for 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol?
The canonical SMILES for 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol is O=[N+]([O-])c1ccc2c(c1)[n+]([O-])c1cc(O)c([N+](=O)[O-])cc1[n+]2[O-].
What is the InChIKey of 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol?
The InChIKey is ZRKBZGXXYPYXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N4O7/c17-12-5-10-9(4-11(12)16(22)23)13(18)7-2-1-6(15(20)21)3-8(7)14(10)19/h1-5,17H.
What are the key properties of 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol?
3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol has a molecular weight of 318.20 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dinitro-5,10-dioxidophenazine-5,10-diium-2-ol is sourced from PubChem (CID 163378657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).