C17H14F3N3O3 — CID 135678799
2-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-prop-2-enylphenol (PubChem CID 135678799) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-prop-2-enylphenol.
| Compound Name | 2-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 135678799 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cccc(/C=N/Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H14F3N3O3/c1-2-4-11-5-3-6-12(16(11)24)10-21-22-14-8-7-13(17(18,19)20)9-15(14)23(25)26/h2-3,5-10,22,24H,1,4H2/b21-10+ |
| InChIKey | YTUCZKXESOQLPH-UFFVCSGVSA-N |
| XLogP | 4.49 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|