C20H21F3N4O4 — CID 126114790
N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126114790) has the molecular formula C20H21F3N4O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126114790 |
| Molecular Formula | C20H21F3N4O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[(E)-(2,5-dimethoxy-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(N2CCCC2)c(OC)cc1/C=N/Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21F3N4O4/c1-30-18-11-17(26-7-3-4-8-26)19(31-2)9-13(18)12-24-25-15-6-5-14(20(21,22)23)10-16(15)27(28)29/h5-6,9-12,25H,3-4,7-8H2,1-2H3/b24-12+ |
| InChIKey | UGVBPIIKSJFTOM-WYMPLXKRSA-N |
| XLogP | 4.68 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|