C16H15ClF3N7O2 — CID 55530917
4-chloro-5-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 55530917) has the molecular formula C16H15ClF3N7O2 and a molecular weight of 429.79 g/mol. Its IUPAC name is 4-chloro-5-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-pyrrolidin-1-ylpyrimidin-2-amine.
| Compound Name | 4-chloro-5-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-pyrrolidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 55530917 |
| Molecular Formula | C16H15ClF3N7O2 |
| Molecular Weight | 429.79 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-chloro-5-[(E)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-6-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | Nc1nc(Cl)c(/C=N/Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(N2CCCC2)n1 |
| InChI | InChI=1S/C16H15ClF3N7O2/c17-13-10(14(24-15(21)23-13)26-5-1-2-6-26)8-22-25-11-4-3-9(16(18,19)20)7-12(11)27(28)29/h3-4,7-8,25H,1-2,5-6H2,(H2,21,23,24)/b22-8+ |
| InChIKey | AUTDXKALCSKTCB-GZIVZEMBSA-N |
| XLogP | 3.69 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|