C13H13N3O6 — CID 27001647
dimethyl (E,4Z)-4-[(2-nitrophenyl)hydrazinylidene]pent-2-enedioate (PubChem CID 27001647) has the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. Its IUPAC name is dimethyl (E,4Z)-4-[(2-nitrophenyl)hydrazinylidene]pent-2-enedioate.
| Compound Name | dimethyl (E,4Z)-4-[(2-nitrophenyl)hydrazinylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 27001647 |
| Molecular Formula | C13H13N3O6 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | dimethyl (E,4Z)-4-[(2-nitrophenyl)hydrazinylidene]pent-2-enedioate |
| SMILES | COC(=O)/C=C/C(=N/Nc1ccccc1[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C13H13N3O6/c1-21-12(17)8-7-10(13(18)22-2)15-14-9-5-3-4-6-11(9)16(19)20/h3-8,14H,1-2H3/b8-7+,15-10- |
| InChIKey | OWLIXUDSWPKSPJ-XDOICYCNSA-N |
| XLogP | 1.26 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|