C18H23N5O3 — CID 43066120
5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 43066120) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 43066120 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)NCCCN2CCCC2=O)=NN1c1ccccc1 |
| InChI | InChI=1S/C18H23N5O3/c19-17(25)15-12-14(21-23(15)13-6-2-1-3-7-13)18(26)20-9-5-11-22-10-4-8-16(22)24/h1-3,6-7,15H,4-5,8-12H2,(H2,19,25)(H,20,26) |
| InChIKey | GNTLVBNNPGULPQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|