C19H24N4O3S — CID 51312508
N-(2-cyclohexylpyrazol-3-yl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 51312508) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 51312508 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccnn1C1CCCCC1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C19H24N4O3S/c24-19(21-18-10-11-20-23(18)16-7-2-1-3-8-16)15-6-4-9-17(14-15)22-12-5-13-27(22,25)26/h4,6,9-11,14,16H,1-3,5,7-8,12-13H2,(H,21,24) |
| InChIKey | VIRSMQFLXWTRDV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |