C16H17F2N3O — CID 51192351
N-(2-cyclohexylpyrazol-3-yl)-3,4-difluorobenzamide (PubChem CID 51192351) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is N-(2-cyclohexylpyrazol-3-yl)-3,4-difluorobenzamide.
| Compound Name | N-(2-cyclohexylpyrazol-3-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 51192351 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-(2-cyclohexylpyrazol-3-yl)-3,4-difluorobenzamide |
| SMILES | O=C(Nc1ccnn1C1CCCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H17F2N3O/c17-13-7-6-11(10-14(13)18)16(22)20-15-8-9-19-21(15)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H,20,22) |
| InChIKey | YLWHMLCIOTYMTN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |