C13H23NO2 — CID 13460560
3-methyl-5-(octoxymethyl)-1,2-oxazole (PubChem CID 13460560) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-methyl-5-(octoxymethyl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(octoxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 13460560 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-methyl-5-(octoxymethyl)-1,2-oxazole |
| SMILES | CCCCCCCCOCc1cc(C)no1 |
| InChI | InChI=1S/C13H23NO2/c1-3-4-5-6-7-8-9-15-11-13-10-12(2)14-16-13/h10H,3-9,11H2,1-2H3 |
| InChIKey | KFSVGUOYZPQJSZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|