C19H30N2O3 — CID 11595187
6-(hexoxymethyl)-3-hexylfuro[2,3-d]pyrimidin-2-one (PubChem CID 11595187) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 6-(hexoxymethyl)-3-hexylfuro[2,3-d]pyrimidin-2-one.
| Compound Name | 6-(hexoxymethyl)-3-hexylfuro[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 11595187 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 6-(hexoxymethyl)-3-hexylfuro[2,3-d]pyrimidin-2-one |
| SMILES | CCCCCCOCc1cc2cn(CCCCCC)c(=O)nc2o1 |
| InChI | InChI=1S/C19H30N2O3/c1-3-5-7-9-11-21-14-16-13-17(24-18(16)20-19(21)22)15-23-12-10-8-6-4-2/h13-14H,3-12,15H2,1-2H3 |
| InChIKey | LJBLDIXKRJMONC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|