C13H24N2O2 — CID 55077772
N-[[5-(pentoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine (PubChem CID 55077772) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[[5-(pentoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(pentoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 55077772 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-[[5-(pentoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine |
| SMILES | CCCCCOCc1cc(CNCCC)no1 |
| InChI | InChI=1S/C13H24N2O2/c1-3-5-6-8-16-11-13-9-12(15-17-13)10-14-7-4-2/h9,14H,3-8,10-11H2,1-2H3 |
| InChIKey | UJVOJGKVDJWYBA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|