C10H16F2N2O2 — CID 82007011
N-[[5-(2,2-difluoroethoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine (PubChem CID 82007011) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-[[5-(2,2-difluoroethoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,2-difluoroethoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82007011 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[[5-(2,2-difluoroethoxymethyl)-1,2-oxazol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(COCC(F)F)on1 |
| InChI | InChI=1S/C10H16F2N2O2/c1-2-3-13-5-8-4-9(16-14-8)6-15-7-10(11)12/h4,10,13H,2-3,5-7H2,1H3 |
| InChIKey | ZMCFPYPGCCZDGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|