C21H30ClN3O2 — CID 119314286
N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119314286) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119314286 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-methyl-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)no1)C(=O)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H29N3O2.ClH/c1-24(21(25)18-11-13-22-14-12-18)15-7-3-6-10-19-16-20(23-26-19)17-8-4-2-5-9-17;/h2,4-5,8-9,16,18,22H,3,6-7,10-15H2,1H3;1H |
| InChIKey | JZBDYEUKKRBYDL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|