C22H32ClN3O3 — CID 120791531
2-amino-N-methyl-2-(oxan-4-yl)-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]acetamide;hydrochloride (PubChem CID 120791531) has the molecular formula C22H32ClN3O3 and a molecular weight of 421.97 g/mol. Its IUPAC name is 2-amino-N-methyl-2-(oxan-4-yl)-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-methyl-2-(oxan-4-yl)-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120791531 |
| Molecular Formula | C22H32ClN3O3 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-amino-N-methyl-2-(oxan-4-yl)-N-[5-(3-phenyl-1,2-oxazol-5-yl)pentyl]acetamide;hydrochloride |
| SMILES | CN(CCCCCc1cc(-c2ccccc2)no1)C(=O)C(N)C1CCOCC1.Cl |
| InChI | InChI=1S/C22H31N3O3.ClH/c1-25(22(26)21(23)18-11-14-27-15-12-18)13-7-3-6-10-19-16-20(24-28-19)17-8-4-2-5-9-17;/h2,4-5,8-9,16,18,21H,3,6-7,10-15,23H2,1H3;1H |
| InChIKey | IUIGKBVSONFIQU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|